Systematic / IUPAC Name: 7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]cyclopentyl]heptanoic acid
ID: Reference1358
Other Names:
Cyclopentaneheptanoic acid, 3,5-dihydroxy-2-(3-hydroxy-1-octenyl)-;
(13E,15S)-9α,11α,15-Trihydroxyprost-13-en-1-oic acid;
(13E,15S)-9α,11α-9,11,15-Trihydroxyprost-13-en-1-oic acid;
(9α,11α,13E,15S)-9,11,15-Trihydroxyprost-13-en-1-oic acid;
Pga F1α
Formula: C20H36O5
Class: Endogenous Metabolites
Prostaglandin F1α mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 393 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/4/2014 8:35:18 AM |
| InChI | InChI=1S/C20H36O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-19,21-23H,2-11,14H2,1H3,(H,24,25)/b13-12+/t15-,16+,17+,18-,19+/m0/s1 |
| InChI Key | DZUXGQBLFALXCR-CDIPTNKSSA-N |
| Canonical SMILES | |
| CAS | 745620 |
| Splash | |
| Other Names |
Cyclopentaneheptanoic acid, 3,5-dihydroxy-2-(3-hydroxy-1-octenyl)-; (13E,15S)-9α,11α,15-Trihydroxyprost-13-en-1-oic acid; (13E,15S)-9α,11α-9,11,15-Trihydroxyprost-13-en-1-oic acid; (9α,11α,13E,15S)-9,11,15-Trihydroxyprost-13-en-1-oic acid; Pga F1α; Prostaglandin F1α |
| ChEBI | CHEBI:28852 |
| ChemIDPlus | 000745620 |
| KEGG | C06475 |
| ChemSpider | 4444441 |
| LipidsMAPs | LMFA03010137 |
| HMDb | HMDB02685 |
| PubChem | 5280939 |
| ChEMBL | CHEMBL1325783 |