Systematic / IUPAC Name: 2-Propan-2-yloxyphenol
ID: Reference13581
Other Names: AA-2533
Formula: C9H12O2
Class: Pesticides/Herbicides
2-Isopropoxyphenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 125 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/14/2025 8:50:17 AM |
| InChI | InChI=1S/C9H12O2/c1-7(2)11-9-6-4-3-5-8(9)10/h3-7,10H,1-2H3 |
| InChI Key | ZNCUUYCDKVNVJH-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)Oc1ccccc1O |
| CAS | |
| Splash | |
| Other Names | AA-2533 |
| ChemSpider | 19709 |
| ChEMBL | CHEMBL3182286 |
| PubChem | 20949 |
| ChEBI | CHEBI:38547 |
| HMDb | HMDB0041804 |