Systematic / IUPAC Name: Propan-2-yl N-(2-methoxy-5-phenylphenyl)iminocarbamate
ID: Reference13582
Other Names:
Isopropyl (E)-(4-methoxy-3-biphenylyl)diazenecarboxylate;
1-Methylethyl 2-(4-methoxy(1,1'-biphenyl)-3-yl)diazenecarboxylate;
AA-2356
Formula: C17H18N2O3
Class: Pesticides/Herbicides
Bifenazate-diazene mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 5318 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/3/2025 8:44:44 AM |
| InChI | InChI=1S/C17H18N2O3/c1-12(2)22-17(20)19-18-15-11-14(9-10-16(15)21-3)13-7-5-4-6-8-13/h4-12H,1-3H3 |
| InChI Key | AGTBLMHWQIEASU-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)OC(=O)N=NC1=C(C=CC(=C1)C2=CC=CC=C2)OC |
| CAS | |
| Splash | |
| Other Names |
Isopropyl (E)-(4-methoxy-3-biphenylyl)diazenecarboxylate; 1-Methylethyl 2-(4-methoxy(1,1'-biphenyl)-3-yl)diazenecarboxylate; AA-2356 |