Systematic / IUPAC Name: Tricyclohexyl(1,2,4-triazol-1-yl)stannane
ID: Reference13587
Other Names: AA-2401
Formula: C20H35N3Sn
Class: Pesticides/Herbicides
Azocyclotin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 180 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/6/2025 8:06:08 AM |
| InChI | InChI=1S/3C6H11.C2H2N3.Sn/c3*1-2-4-6-5-3-1;1-3-2-5-4-1;/h3*1H,2-6H2;1-2H;/q;;;-1;+1 |
| InChI Key | ONHBDDJJTDTLIR-UHFFFAOYSA-N |
| Canonical SMILES | c1ncn([Sn](C2CCCCC2)(C2CCCCC2)C2CCCCC2)n1 |
| CAS | |
| Splash | |
| Other Names | AA-2401 |
| ChemSpider | 21112106 |
| ChEBI | CHEBI:2959 |
| PubChem | 91634 |
| KEGG | C11092 |