Systematic / IUPAC Name: 6-Chloropyridine-2-carboxylic acid
ID: Reference13592
Other Names: AA-2535
Formula: C6H4ClNO2
Class: Pesticides/Herbicides
6-Chloropicolinic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 365 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/14/2025 8:56:17 AM |
| InChI | InChI=1S/C6H4ClNO2/c7-5-3-1-2-4(8-5)6(9)10/h1-3H,(H,9,10) |
| InChI Key | ZLKMOIHCHCMSFW-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)c1cccc(Cl)n1 |
| CAS | |
| Splash | |
| Other Names | AA-2535 |
| ChEMBL | CHEMBL1404320 |
| PubChem | 20812 |
| ChemSpider | 19588 |