Systematic / IUPAC Name: 4,6-Dimethoxypyrimidin-2-amine
ID: Reference13594
Other Names: AA-2537
Formula: C6H9N3O2
Class: Pesticides/Herbicides
2-Amino-4,6-dimethoxypyrimidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 192 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/14/2025 9:04:59 AM |
| InChI | InChI=1S/C6H9N3O2/c1-10-4-3-5(11-2)9-6(7)8-4/h3H,1-2H3,(H2,7,8,9) |
| InChI Key | LVFRCHIUUKWBLR-UHFFFAOYSA-N |
| Canonical SMILES | COc1cc(OC)nc(N)n1 |
| CAS | |
| Splash | |
| Other Names | AA-2537 |