Systematic / IUPAC Name: 3,5,6-Trichloro-1H-pyridin-2-one
ID: Reference13596
Other Names: AA-2539
Formula: C5H2Cl3NO
Class: Pesticides/Herbicides
3,5,6-Trichloro-2-pyridinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 410 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/14/2025 11:21:39 AM |
| InChI | InChI=1S/C5H2Cl3NO/c6-2-1-3(7)5(10)9-4(2)8/h1H,(H,9,10) |
| InChI Key | WCYYAQFQZQEUEN-UHFFFAOYSA-N |
| Canonical SMILES | Oc1nc(Cl)c(Cl)cc1Cl |
| CAS | |
| Splash | |
| Other Names | AA-2539 |
| ChEBI | CHEBI:83490 |
| KEGG | C22282 |
| HMDb | HMDB0039853 |
| PubChem | 23017 |
| ChEMBL | CHEMBL3186214 |
| Wikipedia | TCPy |
| ChemSpider | 21541 |