Systematic / IUPAC Name: 2-[(E)-N-[(3,5-Difluorophenyl)carbamoylamino]-C-methylcarbonimidoyl]pyridine-3-carboxylic acid
ID: Reference13597
Other Names: AA-2365
Formula: C15H12F2N4O3
Class: Pesticides/Herbicides
Diflufenzopyr mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 7510 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/10/2025 12:45:56 PM |
| InChI | InChI=1S/C15H12F2N4O3/c1-8(13-12(14(22)23)3-2-4-18-13)20-21-15(24)19-11-6-9(16)5-10(17)7-11/h2-7H,1H3,(H,22,23)(H2,19,21,24)/b20-8+ |
| InChI Key | IRJQWZWMQCVOLA-DNTJNYDQSA-N |
| Canonical SMILES | C/C(=N\NC(=O)Nc1cc(F)cc(F)c1)c1ncccc1C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-2365 |
| ChemSpider | 4816775 |
| ChEMBL | CHEMBL1907209 |
| PubChem | 6125184 |