Systematic / IUPAC Name: Methyl 2-[(4,6-dimethylpyrimidin-2-yl)carbamoylsulfamoyl]benzoate
ID: Reference13598
Other Names: AA-2368
Formula: C15H16N4O5S
Class: Pesticides/Herbicides
Sulfometuron-methyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 674 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/10/2025 12:50:19 PM |
| InChI | InChI=1S/C15H16N4O5S/c1-9-8-10(2)17-14(16-9)18-15(21)19-25(22,23)12-7-5-4-6-11(12)13(20)24-3/h4-8H,1-3H3,(H2,16,17,18,19,21) |
| InChI Key | ZDXMLEQEMNLCQG-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc1nc(C)cc(C)n1 |
| CAS | |
| Splash | |
| Other Names | AA-2368 |
| KEGG | C10955 |
| PubChem | 52997 |
| ChEBI | CHEBI:9348 |
| ChemSpider | 47881 |
| ChEMBL | CHEMBL513261 |