Systematic / IUPAC Name: Methyl 4-[(3-methoxy-4-methyl-5-oxo-1,2,4-triazole-1-carbonyl)sulfamoyl]-5-methylthiophene-3-carboxylate
ID: Reference13599
Other Names: AA-2369
Formula: C12H14N4O7S2
Class: Pesticides/Herbicides
Thiencarbazone-methyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3758 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/10/2025 12:50:58 PM |
| InChI | InChI=1S/C12H14N4O7S2/c1-6-8(7(5-24-6)9(17)22-3)25(20,21)14-10(18)16-12(19)15(2)11(13-16)23-4/h5H,1-4H3,(H,14,18) |
| InChI Key | XSKZXGDFSCCXQX-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)c1csc(C)c1S(=O)(=O)NC(=O)n1nc(OC)n(C)c1=O |
| CAS | |
| Splash | |
| Other Names | AA-2369 |
| ChEBI | CHEBI:145500 |
| PubChem | 11205153 |
| ChemSpider | 9380215 |