Systematic / IUPAC Name: 3,5-Dichloro-N-(1-chloro-3-methyl-2-oxopentan-3-yl)-4-methylbenzamide
ID: Reference13600
Other Names: AA-2370
Formula: C14H16Cl3NO2
Class: Pesticides/Herbicides
Zoxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3715 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/10/2025 12:51:57 PM |
| InChI | InChI=1S/C14H16Cl3NO2/c1-4-14(3,12(19)7-15)18-13(20)9-5-10(16)8(2)11(17)6-9/h5-6H,4,7H2,1-3H3,(H,18,20) |
| InChI Key | SOUGWDPPRBKJEX-UHFFFAOYSA-N |
| Canonical SMILES | CCC(C)(NC(=O)c1cc(Cl)c(C)c(Cl)c1)C(=O)CCl |
| CAS | |
| Splash | |
| Other Names | AA-2370 |
| PubChem | 122087 |
| ChEMBL | CHEMBL1893025 |
| ChemSpider | 108892 |
| KEGG | C18903 |
| ChEBI | CHEBI:82853 |