Systematic / IUPAC Name: 3-Chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one
ID: Reference13602
Other Names: AA-2406
Formula: C12H10Cl2F3NO
Class: Pesticides/Herbicides
Flurochloridone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 951 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/14/2025 8:23:37 AM |
| InChI | InChI=1S/C12H10Cl2F3NO/c13-5-7-6-18(11(19)10(7)14)9-3-1-2-8(4-9)12(15,16)17/h1-4,7,10H,5-6H2 |
| InChI Key | OQZCSNDVOWYALR-UHFFFAOYSA-N |
| Canonical SMILES | O=C1C(Cl)C(CCl)CN1c1cccc(C(F)(F)F)c1 |
| CAS | |
| Splash | |
| Other Names | AA-2406 |
| ChEMBL | CHEMBL2272973 |
| PubChem | 91677 |
| ChemSpider | 82780 |
| KEGG | C11100 |
| ChEBI | CHEBI:5131 |