Systematic / IUPAC Name: 3,3-Dimethyl-1-(4-phenylphenoxy)-1-(1,2,4-triazol-1-yl)butan-2-ol
ID: Reference13603
Other Names: AA-2409
Formula: C20H23N3O2
Class: Pesticides/Herbicides
Bitertanol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 434 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/14/2025 8:25:14 AM |
| InChI | InChI=1S/C20H23N3O2/c1-20(2,3)18(24)19(23-14-21-13-22-23)25-17-11-9-16(10-12-17)15-7-5-4-6-8-15/h4-14,18-19,24H,1-3H3 |
| InChI Key | VGPIBGGRCVEHQZ-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)C(O)C(Oc1ccc(-c2ccccc2)cc1)n1cncn1 |
| CAS | |
| Splash | |
| Other Names | AA-2409 |
| ChemSpider | 82759 |
| ChEBI | CHEBI:83851 |
| PubChem | 91656 |
| ChEMBL | CHEMBL1566634 |
| KEGG | C11258 |