Systematic / IUPAC Name:
ID: Reference13606
Other Names: AA-3636
Formula: C8H17NO2
Class: Endogenous Metabolites
8-Aminooctanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 884 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/17/2025 12:34:43 PM |
| InChI | InChI=1S/C8H17NO2/c9-7-5-3-1-2-4-6-8(10)11/h1-7,9H2,(H,10,11) |
| InChI Key | UQXNEWQGGVUVQA-UHFFFAOYSA-N |
| Canonical SMILES | NCCCCCCCC(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-3636 |
| PubChem | 6994258; 66085 |
| ChEMBL | CHEMBL196105 |
| ChEBI | CHEBI:143265 |
| LipidsMAPs | LMFA01100059 |
| ChemSpider | 59474 |