Systematic / IUPAC Name: 3,6-Dichloropyridine-2-carboxylic acid
ID: Reference13610
Other Names: AA-2416
Formula: C6H3Cl2NO2
Class: Pesticides/Herbicides
Clopyralid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 315 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/20/2025 8:31:28 AM |
| InChI | InChI=1S/C6H3Cl2NO2/c7-3-1-2-4(8)9-5(3)6(10)11/h1-2H,(H,10,11) |
| InChI Key | HUBANNPOLNYSAD-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)c1nc(Cl)ccc1Cl |
| CAS | |
| Splash | |
| Other Names | AA-2416 |
| ChEMBL | CHEMBL1650605 |
| ChEBI | CHEBI:62961 |
| ChemSpider | 14797 |
| PubChem | 15553 |
| Wikipedia | Clopyralid |
| KEGG | C18779 |