Systematic / IUPAC Name: N-(2-Chloroethyl)-2,6-dinitro-N-propyl-4-(trifluoromethyl)aniline
ID: Reference13611
Other Names: AA-2417
Formula: C12H13ClF3N3O4
Class: Pesticides/Herbicides
Fluchloralin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 344 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/20/2025 8:34:53 AM |
| InChI | InChI=1S/C12H13ClF3N3O4/c1-2-4-17(5-3-13)11-9(18(20)21)6-8(12(14,15)16)7-10(11)19(22)23/h6-7H,2-5H2,1H3 |
| InChI Key | MNFMIVVPXOGUMX-UHFFFAOYSA-N |
| Canonical SMILES | CCCN(CCCl)c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| CAS | |
| Splash | |
| Other Names | AA-2417 |
| ChEMBL | CHEMBL1256704 |
| ChEBI | CHEBI:81919 |
| PubChem | 36392 |
| KEGG | C18730 |
| ChemSpider | 33448 |