Systematic / IUPAC Name:
ID: Reference13612
Other Names: AA-2540
Formula: C8H4F2O4
Class: Pesticides/Herbicides
2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 219 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/24/2025 5:08:55 PM |
| InChI | InChI=1S/C8H4F2O4/c9-8(10)13-5-3-1-2-4(7(11)12)6(5)14-8/h1-3H,(H,11,12) |
| InChI Key | ZGAQVJDFFVTWJK-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)c1cccc2c1OC(F)(F)O2 |
| CAS | |
| Splash | |
| Other Names | AA-2540 |