Systematic / IUPAC Name: 3-(Difluoromethyl)-1-methylpyrazole-4-carboxylic acid
ID: Reference13615
Other Names:
3-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid;
AA-2543
Formula: C6H6F2N2O2
Class: Pesticides/Herbicides
3-Difluoromethyl-1-methylpyrazole-4-carboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 783 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/24/2025 4:58:11 PM |
| InChI | InChI=1S/C6H6F2N2O2/c1-10-2-3(6(11)12)4(9-10)5(7)8/h2,5H,1H3,(H,11,12) |
| InChI Key | RLOHOBNEYHBZID-UHFFFAOYSA-N |
| Canonical SMILES | Cn1cc(C(=O)O)c(C(F)F)n1 |
| CAS | |
| Splash | |
| Other Names |
3-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid; AA-2543 |