Systematic / IUPAC Name: 2,3-Dihydro-1H-indole-2-carboxylic acid
ID: Reference13618
Other Names: AA-3638
Formula: C9H9NO2
Class: Endogenous Metabolites
Indoline-2-carboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 698 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/24/2025 4:40:37 PM |
| InChI | InChI=1S/C9H9NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h1-4,8,10H,5H2,(H,11,12) |
| InChI Key | QNRXNRGSOJZINA-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)C1Cc2ccccc2N1 |
| CAS | |
| Splash | |
| Other Names | AA-3638 |
| ChemSpider | 77654 |
| ChEMBL | CHEMBL23081 |
| PubChem | 86074; 86074 |