Systematic / IUPAC Name: N-(2-Oxo-1H-pyrimidin-6-yl)acetamide
ID: Reference13619
Other Names: AA-3640
Formula: C6H7N3O2
Class: Endogenous Metabolites
N4-Acetylcytosine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 585 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/24/2025 4:42:01 PM |
| InChI | InChI=1S/C6H7N3O2/c1-4(10)8-5-2-3-7-6(11)9-5/h2-3H,1H3,(H2,7,8,9,10,11) |
| InChI Key | IJCKBIINTQEGLY-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)Nc1ccnc(=O)[nH]1 |
| CAS | |
| Splash | |
| Other Names | AA-3640 |
| ChEBI | CHEBI:146134 |
| ChEMBL | CHEMBL3273673 |
| PubChem | 99309 |
| ChemSpider | 89719 |