Systematic / IUPAC Name: [(2R,3R,4S,5R,6S)-3,4,5,6-Tetraacetyloxyoxan-2-yl]methyl acetate
ID: Reference13621
Other Names: AA-3647
Formula: C16H22O11
Class: Endogenous Metabolites
β-D-Glucose pentaacetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 325 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/24/2025 4:43:29 PM |
| InChI | InChI=1S/C16H22O11/c1-7(17)22-6-12-13(23-8(2)18)14(24-9(3)19)15(25-10(4)20)16(27-12)26-11(5)21/h12-16H,6H2,1-5H3/t12-,13-,14+,15-,16-/m1/s1 |
| InChI Key | LPTITAGPBXDDGR-IBEHDNSVSA-N |
| Canonical SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| CAS | |
| Splash | |
| Other Names | AA-3647 |
| PubChem | 2724702 |
| ChemSpider | 2006823 |
| ChEMBL | CHEMBL438446 |
| HMDb | HMDB0034223 |