Systematic / IUPAC Name: 2-Ethyl-3-hydroxypyran-4-one
ID: Reference13622
Other Names: AA-3648
Formula: C7H8O3
Class: Endogenous Metabolites Excipients/Additives/Colorants Personal Care Products/Cosmetics
Ethyl maltol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 262 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/24/2025 4:44:04 PM |
| InChI | InChI=1S/C7H8O3/c1-2-6-7(9)5(8)3-4-10-6/h3-4,9H,2H2,1H3 |
| InChI Key | YIKYNHJUKRTCJL-UHFFFAOYSA-N |
| Canonical SMILES | CCc1occc(=O)c1O |
| CAS | |
| Splash | |
| Other Names | AA-3648 |
| ChEMBL | CHEMBL121557 |
| ChemSpider | 19804 |
| KEGG | C20362 |
| PubChem | 21059 |
| Wikipedia | Ethyl_maltol |
| HMDb | HMDB31735 |