Systematic / IUPAC Name: 3-(2,5-Dimethylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]decan-2-one
ID: Reference13623
Other Names: AA-2423
Formula: C18H25NO3
Class: Pesticides/Herbicides
Spirotetramat-mono-hydroxy mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 7632 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/29/2025 11:23:55 AM |
| InChI | InChI=1S/C18H25NO3/c1-11-4-5-12(2)14(10-11)15-16(20)18(19-17(15)21)8-6-13(22-3)7-9-18/h4-5,10,13,15-16,20H,6-9H2,1-3H3,(H,19,21) |
| InChI Key | HPQGJNTUXNUIDL-UHFFFAOYSA-N |
| Canonical SMILES | COC1CCC2(CC1)NC(=O)C(c1cc(C)ccc1C)C2O |
| CAS | |
| Splash | |
| Other Names | AA-2423 |