Systematic / IUPAC Name: 4-(Dimethylamino)-3-methylphenol
ID: Reference13624
Other Names: AA-2424
Formula: C9H13NO
Class: Pesticides/Herbicides
Aminocarb phenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 480 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/29/2025 9:22:31 AM |
| InChI | InChI=1S/C9H13NO/c1-7-6-8(11)4-5-9(7)10(2)3/h4-6,11H,1-3H3 |
| InChI Key | SZBIKNXBDIVHKY-UHFFFAOYSA-N |
| Canonical SMILES | Cc1cc(O)ccc1N(C)C |
| CAS | |
| Splash | |
| Other Names | AA-2424 |