Systematic / IUPAC Name: 2-Phenylbenzo[H]chromen-4-one
ID: Reference13626
Other Names: AA-3659
Formula: C19H12O2
Class: Endogenous Metabolites
α-Naphthoflavone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 535 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/30/2025 11:22:30 AM |
| InChI | InChI=1S/C19H12O2/c20-17-12-18(14-7-2-1-3-8-14)21-19-15-9-5-4-6-13(15)10-11-16(17)19/h1-12H |
| InChI Key | VFMMPHCGEFXGIP-UHFFFAOYSA-N |
| Canonical SMILES | O=c1cc(-c2ccccc2)oc2c1ccc1ccccc12 |
| CAS | |
| Splash | |
| Other Names | AA-3659 |
| Wikipedia | Alpha-Naphthoflavone |
| ChemSpider | 11297 |
| PubChem | 11790 |
| ChEMBL | CHEMBL283196 |
| DrugBank | DB07453; DB07453 |
| ChEBI | CHEBI:76995 |