Systematic / IUPAC Name: 2-Amino-3-(3-chloro-4-hydroxyphenyl)propanoic acid
ID: Reference13628
Other Names: AA-3667
Formula: C9H10ClNO3
Class: Pesticides/Herbicides
3-Chlorotyrosine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2364 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/30/2025 11:32:03 AM |
| InChI | InChI=1S/C9H10ClNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14) |
| InChI Key | ACWBBAGYTKWBCD-UHFFFAOYSA-N |
| Canonical SMILES | NC(Cc1ccc(O)c(Cl)c1)C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-3667 |
| HMDb | HMDB0001885 |
| ChemSpider | 106510 |
| PubChem | 119226 |