Systematic / IUPAC Name: 2-Amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoic acid
ID: Reference13629
Other Names: AA-3668
Formula: C15H13I2NO4
Class: Endogenous Metabolites
3,5-Diiodo-DL-thyronine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 6512 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/30/2025 11:33:18 AM |
| InChI | InChI=1S/C15H13I2NO4/c16-11-5-8(7-13(18)15(20)21)6-12(17)14(11)22-10-3-1-9(19)2-4-10/h1-6,13,19H,7,18H2,(H,20,21) |
| InChI Key | ZHSOTLOTTDYIIK-UHFFFAOYSA-N |
| Canonical SMILES | NC(Cc1cc(I)c(Oc2ccc(O)cc2)c(I)c1)C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-3668 |
| PubChem | 44366756; 123675 |
| Wikipedia | 3,5-Diiodothyronine |
| ChEBI | CHEBI:89575 |
| ChEMBL | CHEMBL150462 |
| HMDb | HMDB0000582 |
| ChemSpider | 110252 |