Systematic / IUPAC Name: 4-Amino-3,6-dichloropyridine-2-carboxylic acid
ID: Reference13637
Other Names: AA-2434
Formula: C6H4Cl2N2O2
Class: Pesticides/Herbicides
Aminopyralid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2429 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/10/2025 11:35:57 AM |
| InChI | InChI=1S/C6H4Cl2N2O2/c7-3-1-2(9)4(8)5(10-3)6(11)12/h1H,(H2,9,10)(H,11,12) |
| InChI Key | NIXXQNOQHKNPEJ-UHFFFAOYSA-N |
| Canonical SMILES | Nc1cc(Cl)nc(C(=O)O)c1Cl |
| CAS | |
| Splash | |
| Other Names | AA-2434 |
| ChemSpider | 184712 |
| ChEBI | CHEBI:62962 |
| PubChem | 213012 |
| Wikipedia | Aminopyralid |
| ChEMBL | CHEMBL1903787 |