Systematic / IUPAC Name: 1-[Diethoxyphosphorylsulfanylmethylsulfanyl(ethoxy)phosphoryl]oxyethane
ID: Reference13638
Other Names:
O,O,O′,O′-Tetraethyl S,S′-methylene bis(phosphorothioate);
AA-2436
Formula: C9H22O6P2S2
Class: Pesticides/Herbicides
Ethion dioxon mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 5700 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/10/2025 11:21:08 AM |
| InChI | InChI=1S/C9H22O6P2S2/c1-5-12-16(10,13-6-2)18-9-19-17(11,14-7-3)15-8-4/h5-9H2,1-4H3 |
| InChI Key | SSEJHKWNPGJOSI-UHFFFAOYSA-N |
| Canonical SMILES | CCOP(=O)(OCC)SCSP(=O)(OCC)OCC |
| CAS | |
| Splash | |
| Other Names |
O,O,O′,O′-Tetraethyl S,S′-methylene bis(phosphorothioate); AA-2436 |