Systematic / IUPAC Name:
ID: Reference13642
Other Names: AA-2556
Formula: C7H5Cl2NO
Class: Pesticides/Herbicides
3,5-Dichlorobenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 401 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/21/2025 11:10:28 AM |
| InChI | InChI=1S/C7H5Cl2NO/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H2,10,11) |
| InChI Key | DELNZTRPJTUOIP-UHFFFAOYSA-N |
| Canonical SMILES | NC(=O)c1cc(Cl)cc(Cl)c1 |
| CAS | |
| Splash | |
| Other Names | AA-2556 |