Systematic / IUPAC Name:
ID: Reference13643
Other Names: AA-2557
Formula: C8H3Cl3N2O2
Class: Pesticides/Herbicides
2,3,6-Trichloro-5-cyano-4-hydroxybenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1137 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/21/2025 11:08:56 AM |
| InChI | InChI=1S/C8H3Cl3N2O2/c9-4-2(1-12)7(14)6(11)5(10)3(4)8(13)15/h14H,(H2,13,15) |
| InChI Key | WUYYRWIYXBUPBS-UHFFFAOYSA-N |
| Canonical SMILES | N#Cc1c(O)c(Cl)c(Cl)c(C(N)=O)c1Cl |
| CAS | |
| Splash | |
| Other Names | AA-2557 |