Systematic / IUPAC Name: 2-Phenylethyl (E)-3-phenylprop-2-enoate
ID: Reference13652
Other Names: AA-3602
Formula: C17H16O2
Class: Endogenous Metabolites
Phenethyl cinnamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 405 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/19/2025 3:40:07 PM |
| InChI | InChI=1S/C17H16O2/c18-17(12-11-15-7-3-1-4-8-15)19-14-13-16-9-5-2-6-10-16/h1-12H,13-14H2/b12-11+ |
| InChI Key | MJQVZIANGRDJBT-VAWYXSNFSA-N |
| Canonical SMILES | O=C(/C=C/c1ccccc1)OCCc1ccccc1 |
| CAS | |
| Splash | |
| Other Names | AA-3602 |
| HMDb | HMDB0035018 |
| ChEMBL | CHEMBL3184894 |
| ChemSpider | 4520510 |
| PubChem | 5369459 |