Systematic / IUPAC Name: 6-Ethoxy-2-N-methyl-1,3,5-triazine-2,4-diamine
ID: Reference13658
Other Names: AA-2568
Formula: C6H11N5O
Class: Pesticides/Herbicides
2-Amino-4-methylamino-6-ethoxy-1,3,5-triazine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 385 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/21/2025 10:49:14 AM |
| InChI | InChI=1S/C6H11N5O/c1-3-12-6-10-4(7)9-5(8-2)11-6/h3H2,1-2H3,(H3,7,8,9,10,11) |
| InChI Key | HEMSJLNVJJUYEU-UHFFFAOYSA-N |
| Canonical SMILES | CCOc1nc(N)nc(NC)n1 |
| CAS | |
| Splash | |
| Other Names | AA-2568 |