Systematic / IUPAC Name: 5-Methyl-5-phenylimidazolidine-2,4-dione
ID: Reference13660
Other Names: AA-2572
Formula: C10H10N2O2
Class: Pesticides/Herbicides
5-Methyl-5-phenylhydantoin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 340 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/21/2025 10:40:57 AM |
| InChI | InChI=1S/C10H10N2O2/c1-10(7-5-3-2-4-6-7)8(13)11-9(14)12-10/h2-6H,1H3,(H2,11,12,13,14) |
| InChI Key | JNGWGQUYLVSFND-UHFFFAOYSA-N |
| Canonical SMILES | CC1(c2ccccc2)NC(=O)NC1=O |
| CAS | |
| Splash | |
| Other Names | AA-2572 |
| ChEMBL | CHEMBL3546317 |
| PubChem | 93043 |
| ChemSpider | 83995 |