Systematic / IUPAC Name: 5-Phenylpentanoic acid
ID: Reference13662
Other Names:
Benzenepentanoic acid;
AA-3766
Formula: C11H14O2
Class: Endogenous Metabolites
5-Phenylvaleric acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 688 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/21/2025 10:27:18 AM |
| InChI | InChI=1S/C11H14O2/c12-11(13)9-5-4-8-10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H,12,13) |
| InChI Key | BYHDDXPKOZIZRV-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)CCCCc1ccccc1 |
| CAS | |
| Splash | |
| Other Names |
Benzenepentanoic acid; AA-3766 |
| ChEBI | CHEBI:40131 |
| PubChem | 16757 |
| ChEMBL | CHEMBL443064 |
| HMDb | HMDB02043 |
| DrugBank | DB04051 |
| ChemSpider | 15886 |