Systematic / IUPAC Name: (E)-Dodec-2-enedioic acid
ID: Reference13663
Other Names: AA-3775
Formula: C12H20O4
Class: Endogenous Metabolites
Traumatic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4012 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/21/2025 10:30:21 AM |
| InChI | InChI=1S/C12H20O4/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h7,9H,1-6,8,10H2,(H,13,14)(H,15,16)/b9-7+ |
| InChI Key | MAZWDMBCPDUFDJ-VQHVLOKHSA-N |
| Canonical SMILES | O=C(O)/C=C/CCCCCCCCC(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-3775 |
| KEGG | C16308 |
| ChEMBL | CHEMBL470062 |
| PubChem | 5283028 |
| HMDb | HMDB0000933 |
| LipidsMAPs | LMFA01170002 |
| ChemSpider | 4446155 |
| Wikipedia | Traumatic acid |
| ChEBI | CHEBI:545687 |