Systematic / IUPAC Name: 2-[(E)-N-Ethoxy-C-ethylcarbonimidoyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one
ID: Reference13665
Other Names: AA-2450
Formula: C20H27NO3
Class: Pesticides/Herbicides
Tralkoxydim mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4006 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/28/2025 12:31:35 PM |
| InChI | InChI=1S/C20H27NO3/c1-6-16(21-24-7-2)20-17(22)10-15(11-18(20)23)19-13(4)8-12(3)9-14(19)5/h8-9,15,22H,6-7,10-11H2,1-5H3/b21-16+ |
| InChI Key | DQFPEYARZIQXRM-LTGZKZEYSA-N |
| Canonical SMILES | CCO/N=C(\CC)C1=C(O)CC(c2c(C)cc(C)cc2C)CC1=O |
| CAS | |
| Splash | |
| Other Names | AA-2450 |
| ChEBI | CHEBI:81948 |
| KEGG | C18769 |
| ChemSpider | 10469196 |
| PubChem | 135492483 |
| ChEMBL | CHEMBL60556 |