Systematic / IUPAC Name: tert-Butylsulfinylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane
ID: Reference13668
Other Names: AA-2582
Formula: C9H21O3PS3
Class: Pesticides/Herbicides
Terbufos-sulfoxide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 505 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/28/2025 12:40:11 PM |
| InChI | InChI=1S/C9H21O3PS3/c1-6-11-13(14,12-7-2)15-8-16(10)9(3,4)5/h6-8H2,1-5H3 |
| InChI Key | KKOYBOFPUBHPFO-UHFFFAOYSA-N |
| Canonical SMILES | CCOP(=S)(OCC)SCS(=O)C(C)(C)C |
| CAS | |
| Splash | |
| Other Names | AA-2582 |