Systematic / IUPAC Name: Methyl (2R)-2-(N-(2-methoxyacetyl)-2,6-dimethylanilino)propanoate
ID: Reference13669
Other Names:
(R)-Metalaxyl;
AA-2583
Formula: C15H21NO4
Class: Pesticides/Herbicides
Metalaxyl-M mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 375 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/28/2025 12:43:38 PM |
| InChI | InChI=1S/C15H21NO4/c1-10-7-6-8-11(2)14(10)16(13(17)9-19-4)12(3)15(18)20-5/h6-8,12H,9H2,1-5H3/t12-/m1/s1 |
| InChI Key | ZQEIXNIJLIKNTD-GFCCVEGCSA-N |
| Canonical SMILES | COCC(=O)N(c1c(C)cccc1C)[C@H](C)C(=O)OC |
| CAS | |
| Splash | |
| Other Names |
(R)-Metalaxyl; AA-2583 |
| ChEBI | CHEBI:60607 |
| ChEMBL | CHEMBL1905521 |
| PubChem | 11150163 |
| KEGG | C18626 |
| ChemSpider | 9325271 |