Systematic / IUPAC Name: (3,3-Dimethyl-2H-1-benzofuran-5-yl) ethanesulfonate
ID: Reference13673
Other Names: AA-2453
Formula: C12H16O4S
Class: Pesticides/Herbicides
Benfuresate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2228 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/8/2025 10:00:46 AM |
| InChI | InChI=1S/C12H16O4S/c1-4-17(13,14)16-9-5-6-11-10(7-9)12(2,3)8-15-11/h5-7H,4,8H2,1-3H3 |
| InChI Key | QGQSRQPXXMTJCM-UHFFFAOYSA-N |
| Canonical SMILES | CCS(=O)(=O)Oc1ccc2c(c1)C(C)(C)CO2 |
| CAS | |
| Splash | |
| Other Names | AA-2453 |
| KEGG | C18452 |
| PubChem | 3034378 |
| ChemSpider | 2298853 |
| ChEMBL | CHEMBL2252194 |
| ChEBI | CHEBI:81756 |