Systematic / IUPAC Name: 3-(3-Methoxyphenyl)propanoic acid
ID: Reference13681
Other Names: AA-3702
Formula: C10H12O3
Class: Endogenous Metabolites
3-Methoxyhydrocinnamic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1614 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/15/2025 10:35:32 AM |
| InChI | InChI=1S/C10H12O3/c1-13-9-4-2-3-8(7-9)5-6-10(11)12/h2-4,7H,5-6H2,1H3,(H,11,12) |
| InChI Key | BJJQJLOZWBZEGA-UHFFFAOYSA-N |
| Canonical SMILES | COc1cccc(CCC(=O)O)c1 |
| CAS | |
| Splash | |
| Other Names | AA-3702 |
| PubChem | 66336 |
| ChEBI | CHEBI:88439 |
| ChemSpider | 59714 |
| HMDb | HMDB0011751; HMDB0011751; HMDB0011751 |