Systematic / IUPAC Name: 1-(4-tert-Butyl-2,6-dimethyl-3,5-dinitrophenyl)ethanone
ID: Reference13682
Other Names: AA-3815
Formula: C14H18N2O5
Class: Endogenous Metabolites
Musk ketone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 595 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/12/2025 2:22:39 PM |
| InChI | InChI=1S/C14H18N2O5/c1-7-10(9(3)17)8(2)13(16(20)21)11(14(4,5)6)12(7)15(18)19/h1-6H3 |
| InChI Key | WXCMHFPAUCOJIG-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)c1c(C)c([N+](=O)[O-])c(C(C)(C)C)c([N+](=O)[O-])c1C |
| CAS | |
| Splash | |
| Other Names | AA-3815 |
| ChemSpider | More details; 6417 |
| ChEMBL | CHEMBL1877463 |
| HMDb | HMDB0031865 |
| PubChem | 6669 |