Systematic / IUPAC Name: 1-(2-Hydroxy-4,6-dimethoxyphenyl)ethanone
ID: Reference13683
Other Names: AA-3819
Formula: C10H12O4
Class: Endogenous Metabolites
Xanthoxylin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1254 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/12/2025 2:24:03 PM |
| InChI | InChI=1S/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
| InChI Key | FBUBVLUPUDBFME-UHFFFAOYSA-N |
| Canonical SMILES | COc1cc(O)c(C(C)=O)c(OC)c1 |
| CAS | |
| Splash | |
| Other Names | AA-3819 |
| Wikipedia | Brevifolin |
| KEGG | C10726 |
| ChEBI | CHEBI:10070 |
| PubChem | 66654 |
| ChEMBL | CHEMBL450288 |
| ChemSpider | 60021 |
| HMDb | HMDB0029645 |