Systematic / IUPAC Name: N-[2-(2-Cyclopropylcyclopropyl)phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide
ID: Reference13688
Other Names: AA-2488
Formula: C18H19F2N3O
Class: Pesticides/Herbicides
Sedaxane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4144 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/15/2025 10:26:15 AM |
| InChI | InChI=1S/C18H19F2N3O/c1-23-9-14(16(22-23)17(19)20)18(24)21-15-5-3-2-4-11(15)13-8-12(13)10-6-7-10/h2-5,9-10,12-13,17H,6-8H2,1H3,(H,21,24) |
| InChI Key | XQJQCBDIXRIYRP-UHFFFAOYSA-N |
| Canonical SMILES | Cn1cc(C(=O)Nc2ccccc2C2CC2C2CC2)c(C(F)F)n1 |
| CAS | |
| Splash | |
| Other Names | AA-2488 |
| ChemSpider | 9863260 |
| PubChem | 11688533 |
| ChEBI | CHEBI:83174 |
| Wikipedia | Sedaxane |