Systematic / IUPAC Name: (2,3,5-Trimethylphenyl) N-methylcarbamate
ID: Reference13689
Other Names: AA-2489
Formula: C11H15NO2
Class: Pesticides/Herbicides
2,3,5-Trimethacarb mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1100 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/15/2025 10:23:58 AM |
| InChI | InChI=1S/C11H15NO2/c1-7-5-8(2)9(3)10(6-7)14-11(13)12-4/h5-6H,1-4H3,(H,12,13) |
| InChI Key | NYOKZHDTNBDPOB-UHFFFAOYSA-N |
| Canonical SMILES | CNC(=O)Oc1cc(C)cc(C)c1C |
| CAS | |
| Splash | |
| Other Names | AA-2489 |
| ChemSpider | 23827 |
| KEGG | C18957 |
| PubChem | 25550 |
| ChEBI | CHEBI:38893 |