Systematic / IUPAC Name: (2E)-2-[(Anthracen-9-yl)methylidene]-N-propylhydrazine-1-carbothioamide
ID: Reference13691
Other Names: 166_9AntTSKPr
Formula: C19H19N3S
1-[(E)-[(Anthracen-9-yl)methylidene]amino]-3-propylthiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1855 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/15/2025 9:42:13 AM |
| InChI | InChI=1S/C19H19N3S/c1-2-11-20-19(23)22-21-13-18-16-9-5-3-7-14(16)12-15-8-4-6-10-17(15)18/h3-10,12-13H,2,11H2,1H3,(H2,20,22,23)/b21-13+ |
| InChI Key | FGBQDCJTFYMJLS-FYJGNVAPSA-N |
| Canonical SMILES | CCCNC(=S)N\N=C\c1c2ccccc2cc2ccccc21 |
| CAS | |
| Splash | |
| Other Names | 166_9AntTSKPr |