Systematic / IUPAC Name: (2E)-2-[(Anthracen-9-yl)methylidene]-N-(2-methylpropyl)hydrazine-1-carbothioamide
ID: Reference13692
Other Names: 167_9AntTSKiBu
Formula: C20H21N3S
1-[(E)-[(Anthracen-9-yl)methylidene]amino]-3-(2-methylpropyl)thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2084 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/15/2025 9:35:10 AM |
| InChI | InChI=1S/C20H21N3S/c1-14(2)12-21-20(24)23-22-13-19-17-9-5-3-7-15(17)11-16-8-4-6-10-18(16)19/h3-11,13-14H,12H2,1-2H3,(H2,21,23,24)/b22-13+ |
| InChI Key | BRCJSJBWLJIQJN-LPYMAVHISA-N |
| Canonical SMILES | CC(C)CNC(=S)N\N=C\c1c2ccccc2cc2ccccc21 |
| CAS | |
| Splash | |
| Other Names | 167_9AntTSKiBu |