Systematic / IUPAC Name: (E)-3-(2-Methoxyphenyl)prop-2-enal
ID: Reference13694
Other Names: AA-3713
Formula: C10H10O2
Class: Endogenous Metabolites
2-Methoxycinnamaldehyde mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1388 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/2/2026 10:29:08 AM |
| InChI | InChI=1S/C10H10O2/c1-12-10-7-3-2-5-9(10)6-4-8-11/h2-8H,1H3/b6-4+ |
| InChI Key | KKVZAVRSVHUSPL-GQCTYLIASA-N |
| Canonical SMILES | COc1ccccc1/C=C/C=O |
| CAS | |
| Splash | |
| Other Names | AA-3713 |
| HMDb | HMDB0033830 |
| ChemSpider | 556589 |
| PubChem | 641298 |
| ChEMBL | CHEMBL83159 |