Systematic / IUPAC Name: 1,4-Bis(butylamino)anthracene-9,10-dione
ID: Reference13698
Other Names: AA-3620
Formula: C22H26N2O2
Class: Endogenous Metabolites
Solvent blue 35 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 700 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/18/2025 9:25:23 AM |
| InChI | InChI=1S/C22H26N2O2/c1-3-5-13-23-17-11-12-18(24-14-6-4-2)20-19(17)21(25)15-9-7-8-10-16(15)22(20)26/h7-12,23-24H,3-6,13-14H2,1-2H3 |
| InChI Key | OCQDPIXQTSYZJL-UHFFFAOYSA-N |
| Canonical SMILES | CCCCNc1ccc(NCCCC)c2c1C(=O)c1ccccc1C2=O |
| CAS | |
| Splash | |
| Other Names | AA-3620 |
| ChEMBL | CHEMBL3561395 |
| PubChem | 3766139 |
| Wikipedia | Oil Blue 35 |
| ChemSpider | 2994956 |