Systematic / IUPAC Name: 4-Hydroxycyclohexane-1-carboxylic acid
ID: Reference13699
Other Names: AA-3628
Formula: C7H12O3
Class: Endogenous Metabolites
trans-4-Hydroxycyclohexanecarboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 175 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/18/2025 9:33:47 AM |
| InChI | InChI=1S/C7H12O3/c8-6-3-1-5(2-4-6)7(9)10/h5-6,8H,1-4H2,(H,9,10) |
| InChI Key | HCFRWBBJISAZNK-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)C1CCC(O)CC1 |
| CAS | |
| Splash | |
| Other Names | AA-3628 |
| ChemSpider | 133210 |
| HMDb | HMDB0001988 |
| ChEBI | CHEBI:89341 |
| PubChem | 151138 |